About 3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobutanoic acid
3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobutanoic acid (PubChem CID 106397921) has the molecular formula C8H12N4O4
and a molecular weight of 228.21 g/mol. Its IUPAC name is 3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobutanoic acid |
| PubChem CID | 106397921 |
| Molecular Formula | C8H12N4O4 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobutanoic acid |
| SMILES | NC(CC(=O)O)C(=O)NCCc1ncon1 |
| InChI | InChI=1S/C8H12N4O4/c9-5(3-7(13)14)8(15)10-2-1-6-11-4-16-12-6/h4-5H,1-3,9H2,(H,10,15)(H,13,14) |
| InChIKey | VAFXFVPUQXHUPO-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobutanoic acid?
The IUPAC name of 3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobutanoic acid (CID 106397921) is 3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobutanoic acid.
What is the SMILES notation for 3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobutanoic acid?
The canonical SMILES for 3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobutanoic acid is NC(CC(=O)O)C(=O)NCCc1ncon1.
What is the InChIKey of 3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobutanoic acid?
The InChIKey is VAFXFVPUQXHUPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O4/c9-5(3-7(13)14)8(15)10-2-1-6-11-4-16-12-6/h4-5H,1-3,9H2,(H,10,15)(H,13,14).
What are the key properties of 3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobutanoic acid?
3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobutanoic acid has a molecular weight of 228.21 g/mol, XLogP of -1.47, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobutanoic acid is sourced from PubChem (CID 106397921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).