C10H16N4O2 — CID 106398114
2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]-N-prop-2-enylpropanamide (PubChem CID 106398114) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]-N-prop-2-enylpropanamide.
| Compound Name | 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 106398114 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)NCc1noc(C)n1 |
| InChI | InChI=1S/C10H16N4O2/c1-4-5-11-10(15)7(2)12-6-9-13-8(3)16-14-9/h4,7,12H,1,5-6H2,2-3H3,(H,11,15) |
| InChIKey | WUZHHMMPRCWPBV-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|