C15H22N2O2 — CID 106398265
(2S)-2-amino-N-(2-but-3-enoxyethyl)-3-phenylpropanamide (PubChem CID 106398265) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-but-3-enoxyethyl)-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-(2-but-3-enoxyethyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 106398265 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (2S)-2-amino-N-(2-but-3-enoxyethyl)-3-phenylpropanamide |
| SMILES | C=CCCOCCNC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C15H22N2O2/c1-2-3-10-19-11-9-17-15(18)14(16)12-13-7-5-4-6-8-13/h2,4-8,14H,1,3,9-12,16H2,(H,17,18)/t14-/m0/s1 |
| InChIKey | HPKVPWMWVDZNFZ-AWEZNQCLSA-N |
| XLogP | 1.27 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|