About N-cyclopentyl-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide
N-cyclopentyl-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide (PubChem CID 106398957) has the molecular formula C10H16N4O2
and a molecular weight of 224.26 g/mol. Its IUPAC name is N-cyclopentyl-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide.
Molecular Properties
| Compound Name | N-cyclopentyl-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide |
| PubChem CID | 106398957 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-cyclopentyl-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide |
| SMILES | O=C(CNCc1ncon1)NC1CCCC1 |
| InChI | InChI=1S/C10H16N4O2/c15-10(13-8-3-1-2-4-8)6-11-5-9-12-7-16-14-9/h7-8,11H,1-6H2,(H,13,15) |
| InChIKey | YCPAUEKVVADLGV-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclopentyl-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide?
The IUPAC name of N-cyclopentyl-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide (CID 106398957) is N-cyclopentyl-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide.
What is the SMILES notation for N-cyclopentyl-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide?
The canonical SMILES for N-cyclopentyl-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide is O=C(CNCc1ncon1)NC1CCCC1.
What is the InChIKey of N-cyclopentyl-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide?
The InChIKey is YCPAUEKVVADLGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O2/c15-10(13-8-3-1-2-4-8)6-11-5-9-12-7-16-14-9/h7-8,11H,1-6H2,(H,13,15).
What are the key properties of N-cyclopentyl-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide?
N-cyclopentyl-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide has a molecular weight of 224.26 g/mol, XLogP of 0.22, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide is sourced from PubChem (CID 106398957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).