C17H17N3O2S — CID 10639929
1-(3-aminophenyl)-7,8-dimethoxy-3,5-dihydro-2,3-benzodiazepine-4-thione (PubChem CID 10639929) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-(3-aminophenyl)-7,8-dimethoxy-3,5-dihydro-2,3-benzodiazepine-4-thione.
| Compound Name | 1-(3-aminophenyl)-7,8-dimethoxy-3,5-dihydro-2,3-benzodiazepine-4-thione |
|---|---|
| PubChem CID | 10639929 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 1-(3-aminophenyl)-7,8-dimethoxy-3,5-dihydro-2,3-benzodiazepine-4-thione |
| SMILES | COc1cc2c(cc1OC)C(c1cccc(N)c1)=NNC(=S)C2 |
| InChI | InChI=1S/C17H17N3O2S/c1-21-14-7-11-8-16(23)19-20-17(13(11)9-15(14)22-2)10-4-3-5-12(18)6-10/h3-7,9H,8,18H2,1-2H3,(H,19,23) |
| InChIKey | UXRNKXPXZFQXRL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|