C20H25NOS — CID 10639957
2-(benzylsulfanylmethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine (PubChem CID 10639957) has the molecular formula C20H25NOS and a molecular weight of 327.49 g/mol. Its IUPAC name is 2-(benzylsulfanylmethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine.
| Compound Name | 2-(benzylsulfanylmethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 10639957 |
| Molecular Formula | C20H25NOS |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 2-(benzylsulfanylmethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine |
| SMILES | Cc1c(C)c2c(c(C)c1N)CC(C)(CSCc1ccccc1)O2 |
| InChI | InChI=1S/C20H25NOS/c1-13-14(2)19-17(15(3)18(13)21)10-20(4,22-19)12-23-11-16-8-6-5-7-9-16/h5-9H,10-12,21H2,1-4H3 |
| InChIKey | QZBIXUFOADJZKN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|