About 3-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-1-amine
3-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-1-amine (PubChem CID 106399606) has the molecular formula C10H15N5O
and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-1-amine.
Molecular Properties
| Compound Name | 3-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-1-amine |
| PubChem CID | 106399606 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 3-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-1-amine |
| SMILES | c1cn(CCCNCCc2ncno2)cn1 |
| InChI | InChI=1S/C10H15N5O/c1(6-15-7-5-12-9-15)3-11-4-2-10-13-8-14-16-10/h5,7-9,11H,1-4,6H2 |
| InChIKey | IJLIYTAXEJVXAM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-1-amine?
The IUPAC name of 3-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-1-amine (CID 106399606) is 3-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-1-amine.
What is the SMILES notation for 3-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-1-amine?
The canonical SMILES for 3-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-1-amine is c1cn(CCCNCCc2ncno2)cn1.
What is the InChIKey of 3-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-1-amine?
The InChIKey is IJLIYTAXEJVXAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O/c1(6-15-7-5-12-9-15)3-11-4-2-10-13-8-14-16-10/h5,7-9,11H,1-4,6H2.
What are the key properties of 3-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-1-amine?
3-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-1-amine has a molecular weight of 221.26 g/mol, XLogP of 0.49, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-1-amine is sourced from PubChem (CID 106399606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).