C10H14N4OS — CID 106399630
N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine (PubChem CID 106399630) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine.
| Compound Name | N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 106399630 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine |
| SMILES | Cc1nc(CNCCc2ncno2)sc1C |
| InChI | InChI=1S/C10H14N4OS/c1-7-8(2)16-10(14-7)5-11-4-3-9-12-6-13-15-9/h6,11H,3-5H2,1-2H3 |
| InChIKey | HQLHVWXTWAZBSK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|