C6H9F2N3O — CID 106399946
2,2-difluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]ethanamine (PubChem CID 106399946) has the molecular formula C6H9F2N3O and a molecular weight of 177.15 g/mol. Its IUPAC name is 2,2-difluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]ethanamine.
| Compound Name | 2,2-difluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 106399946 |
| Molecular Formula | C6H9F2N3O |
| Molecular Weight | 177.15 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 2,2-difluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]ethanamine |
| SMILES | FC(F)CNCCc1ncno1 |
| InChI | InChI=1S/C6H9F2N3O/c7-5(8)3-9-2-1-6-10-4-11-12-6/h4-5,9H,1-3H2 |
| InChIKey | WCDRBVSNBSKBQE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.15 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|