C8H11F3N4O2 — CID 106400151
2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 106400151) has the molecular formula C8H11F3N4O2 and a molecular weight of 252.20 g/mol. Its IUPAC name is 2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 106400151 |
| Molecular Formula | C8H11F3N4O2 |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CNCCc1ncno1)NCC(F)(F)F |
| InChI | InChI=1S/C8H11F3N4O2/c9-8(10,11)4-13-6(16)3-12-2-1-7-14-5-15-17-7/h5,12H,1-4H2,(H,13,16) |
| InChIKey | OECIALJPRPWYBW-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|