C8H12F3N5O2 — CID 106400241
3,3,3-trifluoro-N'-hydroxy-2-[[2-(1,2,4-oxadiazol-3-yl)ethylamino]methyl]propanimidamide (PubChem CID 106400241) has the molecular formula C8H12F3N5O2 and a molecular weight of 267.21 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[[2-(1,2,4-oxadiazol-3-yl)ethylamino]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[[2-(1,2,4-oxadiazol-3-yl)ethylamino]methyl]propanimidamide |
|---|---|
| PubChem CID | 106400241 |
| Molecular Formula | C8H12F3N5O2 |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[[2-(1,2,4-oxadiazol-3-yl)ethylamino]methyl]propanimidamide |
| SMILES | NC(=NO)C(CNCCc1ncon1)C(F)(F)F |
| InChI | InChI=1S/C8H12F3N5O2/c9-8(10,11)5(7(12)15-17)3-13-2-1-6-14-4-18-16-6/h4-5,13,17H,1-3H2,(H2,12,15) |
| InChIKey | UOKFMQFPBUSGHI-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|