About 2-methyl-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanoic acid
2-methyl-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanoic acid (PubChem CID 106400408) has the molecular formula C8H13N3O3
and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-methyl-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanoic acid.
Molecular Properties
| Compound Name | 2-methyl-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanoic acid |
| PubChem CID | 106400408 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-methyl-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanoic acid |
| SMILES | CC(CNCCc1ncon1)C(=O)O |
| InChI | InChI=1S/C8H13N3O3/c1-6(8(12)13)4-9-3-2-7-10-5-14-11-7/h5-6,9H,2-4H2,1H3,(H,12,13) |
| InChIKey | JIGBFKWBARDXRT-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanoic acid?
The IUPAC name of 2-methyl-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanoic acid (CID 106400408) is 2-methyl-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanoic acid.
What is the SMILES notation for 2-methyl-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanoic acid?
The canonical SMILES for 2-methyl-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanoic acid is CC(CNCCc1ncon1)C(=O)O.
What is the InChIKey of 2-methyl-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanoic acid?
The InChIKey is JIGBFKWBARDXRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3/c1-6(8(12)13)4-9-3-2-7-10-5-14-11-7/h5-6,9H,2-4H2,1H3,(H,12,13).
What are the key properties of 2-methyl-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanoic acid?
2-methyl-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanoic acid has a molecular weight of 199.21 g/mol, XLogP of -0.08, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propanoic acid is sourced from PubChem (CID 106400408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).