C17H32O4Si — CID 10640042
(2R,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(3-methylbut-2-enoxy)-3,6-dihydro-2H-pyran-3-ol (PubChem CID 10640042) has the molecular formula C17H32O4Si and a molecular weight of 328.53 g/mol. Its IUPAC name is (2R,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(3-methylbut-2-enoxy)-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2R,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(3-methylbut-2-enoxy)-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 10640042 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | (2R,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(3-methylbut-2-enoxy)-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CC(C)=CCO[C@@H]1C=C[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C17H32O4Si/c1-13(2)10-11-19-16-9-8-14(18)15(21-16)12-20-22(6,7)17(3,4)5/h8-10,14-16,18H,11-12H2,1-7H3/t14-,15+,16-/m0/s1 |
| InChIKey | HFLGFICTZPDUAN-XHSDSOJGSA-N |
| XLogP | 3.63 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|