C13H13N5O2 — CID 106400461
2-[[2-(1,2,4-oxadiazol-3-yl)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 106400461) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-[[2-(1,2,4-oxadiazol-3-yl)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[[2-(1,2,4-oxadiazol-3-yl)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 106400461 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2-[[2-(1,2,4-oxadiazol-3-yl)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(CNCCc2ncon2)nc2ccccn12 |
| InChI | InChI=1S/C13H13N5O2/c19-13-7-10(16-12-3-1-2-6-18(12)13)8-14-5-4-11-15-9-20-17-11/h1-3,6-7,9,14H,4-5,8H2 |
| InChIKey | OBRVNZTYPJUKBB-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|