C8H11N3O — CID 106400759
N-[2-(1,2,4-oxadiazol-3-yl)ethyl]but-3-yn-2-amine (PubChem CID 106400759) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is N-[2-(1,2,4-oxadiazol-3-yl)ethyl]but-3-yn-2-amine.
| Compound Name | N-[2-(1,2,4-oxadiazol-3-yl)ethyl]but-3-yn-2-amine |
|---|---|
| PubChem CID | 106400759 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | N-[2-(1,2,4-oxadiazol-3-yl)ethyl]but-3-yn-2-amine |
| SMILES | C#CC(C)NCCc1ncon1 |
| InChI | InChI=1S/C8H11N3O/c1-3-7(2)9-5-4-8-10-6-12-11-8/h1,6-7,9H,4-5H2,2H3 |
| InChIKey | AGLZCQGSAWVDDG-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|