C8H10F3N3O3 — CID 106401873
3,3,3-trifluoro-2-[[2-(1,2,4-oxadiazol-5-yl)ethylamino]methyl]propanoic acid (PubChem CID 106401873) has the molecular formula C8H10F3N3O3 and a molecular weight of 253.18 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[[2-(1,2,4-oxadiazol-5-yl)ethylamino]methyl]propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-[[2-(1,2,4-oxadiazol-5-yl)ethylamino]methyl]propanoic acid |
|---|---|
| PubChem CID | 106401873 |
| Molecular Formula | C8H10F3N3O3 |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 3,3,3-trifluoro-2-[[2-(1,2,4-oxadiazol-5-yl)ethylamino]methyl]propanoic acid |
| SMILES | O=C(O)C(CNCCc1ncno1)C(F)(F)F |
| InChI | InChI=1S/C8H10F3N3O3/c9-8(10,11)5(7(15)16)3-12-2-1-6-13-4-14-17-6/h4-5,12H,1-3H2,(H,15,16) |
| InChIKey | STSFBCXLDQVSNK-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|