About 1-(2-but-3-enoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde
1-(2-but-3-enoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde (PubChem CID 106402129) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-(2-but-3-enoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde.
Molecular Properties
| Compound Name | 1-(2-but-3-enoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde |
| PubChem CID | 106402129 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1-(2-but-3-enoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde |
| SMILES | C=CCCOCCn1c(C)cc(C=O)c1C |
| InChI | InChI=1S/C13H19NO2/c1-4-5-7-16-8-6-14-11(2)9-13(10-15)12(14)3/h4,9-10H,1,5-8H2,2-3H3 |
| InChIKey | PCBHKSRNXQIRPX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-but-3-enoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-but-3-enoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde?
The IUPAC name of 1-(2-but-3-enoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde (CID 106402129) is 1-(2-but-3-enoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde.
What is the SMILES notation for 1-(2-but-3-enoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde?
The canonical SMILES for 1-(2-but-3-enoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde is C=CCCOCCn1c(C)cc(C=O)c1C.
What is the InChIKey of 1-(2-but-3-enoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde?
The InChIKey is PCBHKSRNXQIRPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-4-5-7-16-8-6-14-11(2)9-13(10-15)12(14)3/h4,9-10H,1,5-8H2,2-3H3.
What are the key properties of 1-(2-but-3-enoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde?
1-(2-but-3-enoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde has a molecular weight of 221.30 g/mol, XLogP of 2.51, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-but-3-enoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde is sourced from PubChem (CID 106402129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).