C11H19NO3 — CID 106402209
(Z)-4-(2-but-3-enoxyethylamino)-2-methylbut-2-enoic acid (PubChem CID 106402209) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is (Z)-4-(2-but-3-enoxyethylamino)-2-methylbut-2-enoic acid.
| Compound Name | (Z)-4-(2-but-3-enoxyethylamino)-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 106402209 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | (Z)-4-(2-but-3-enoxyethylamino)-2-methylbut-2-enoic acid |
| SMILES | C=CCCOCCNC/C=C(/C)C(=O)O |
| InChI | InChI=1S/C11H19NO3/c1-3-4-8-15-9-7-12-6-5-10(2)11(13)14/h3,5,12H,1,4,6-9H2,2H3,(H,13,14)/b10-5- |
| InChIKey | PFTHOYUZMYVAED-YHYXMXQVSA-N |
| XLogP | 1.20 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|