C12H10N4O3 — CID 106402524
5-amino-2-[2-(1,2,4-oxadiazol-3-yl)ethyl]isoindole-1,3-dione (PubChem CID 106402524) has the molecular formula C12H10N4O3 and a molecular weight of 258.24 g/mol. Its IUPAC name is 5-amino-2-[2-(1,2,4-oxadiazol-3-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 5-amino-2-[2-(1,2,4-oxadiazol-3-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 106402524 |
| Molecular Formula | C12H10N4O3 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 5-amino-2-[2-(1,2,4-oxadiazol-3-yl)ethyl]isoindole-1,3-dione |
| SMILES | Nc1ccc2c(c1)C(=O)N(CCc1ncon1)C2=O |
| InChI | InChI=1S/C12H10N4O3/c13-7-1-2-8-9(5-7)12(18)16(11(8)17)4-3-10-14-6-19-15-10/h1-2,5-6H,3-4,13H2 |
| InChIKey | UWWWBRVGPNZIIQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|