About 3-methyl-N-prop-2-ynyl-1,3-benzoxazol-3-ium-2-amine
3-methyl-N-prop-2-ynyl-1,3-benzoxazol-3-ium-2-amine (PubChem CID 10640289) has the molecular formula C11H11N2O+
and a molecular weight of 187.22 g/mol. Its IUPAC name is 3-methyl-N-prop-2-ynyl-1,3-benzoxazol-3-ium-2-amine.
Molecular Properties
| Compound Name | 3-methyl-N-prop-2-ynyl-1,3-benzoxazol-3-ium-2-amine |
| PubChem CID | 10640289 |
| Molecular Formula | C11H11N2O+ |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | 3-methyl-N-prop-2-ynyl-1,3-benzoxazol-3-ium-2-amine |
| SMILES | C#CCNc1oc2ccccc2[n+]1C |
| InChI | InChI=1S/C11H10N2O/c1-3-8-12-11-13(2)9-6-4-5-7-10(9)14-11/h1,4-7H,8H2,2H3/p+1 |
| InChIKey | NHEKWARUIUQQFH-UHFFFAOYSA-O |
| XLogP | 1.30 |
| TPSA | 29.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-N-prop-2-ynyl-1,3-benzoxazol-3-ium-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-prop-2-ynyl-1,3-benzoxazol-3-ium-2-amine?
The IUPAC name of 3-methyl-N-prop-2-ynyl-1,3-benzoxazol-3-ium-2-amine (CID 10640289) is 3-methyl-N-prop-2-ynyl-1,3-benzoxazol-3-ium-2-amine.
What is the SMILES notation for 3-methyl-N-prop-2-ynyl-1,3-benzoxazol-3-ium-2-amine?
The canonical SMILES for 3-methyl-N-prop-2-ynyl-1,3-benzoxazol-3-ium-2-amine is C#CCNc1oc2ccccc2[n+]1C.
What is the InChIKey of 3-methyl-N-prop-2-ynyl-1,3-benzoxazol-3-ium-2-amine?
The InChIKey is NHEKWARUIUQQFH-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H10N2O/c1-3-8-12-11-13(2)9-6-4-5-7-10(9)14-11/h1,4-7H,8H2,2H3/p+1.
What are the key properties of 3-methyl-N-prop-2-ynyl-1,3-benzoxazol-3-ium-2-amine?
3-methyl-N-prop-2-ynyl-1,3-benzoxazol-3-ium-2-amine has a molecular weight of 187.22 g/mol, XLogP of 1.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-prop-2-ynyl-1,3-benzoxazol-3-ium-2-amine is sourced from PubChem (CID 10640289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).