C13H14N4O4 — CID 106403730
3-[[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoylamino]methyl]benzoic acid (PubChem CID 106403730) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is 3-[[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoylamino]methyl]benzoic acid.
| Compound Name | 3-[[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 106403730 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 3-[[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoylamino]methyl]benzoic acid |
| SMILES | O=C(NCCc1ncno1)NCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C13H14N4O4/c18-12(19)10-3-1-2-9(6-10)7-15-13(20)14-5-4-11-16-8-17-21-11/h1-3,6,8H,4-5,7H2,(H,18,19)(H2,14,15,20) |
| InChIKey | BNRPIEWBVCJFQF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |