C13H24N3O5P — CID 10640381
4-[2-[di(propan-2-yloxy)phosphorylmethoxy]ethoxy]pyrimidin-2-amine (PubChem CID 10640381) has the molecular formula C13H24N3O5P and a molecular weight of 333.33 g/mol. Its IUPAC name is 4-[2-[di(propan-2-yloxy)phosphorylmethoxy]ethoxy]pyrimidin-2-amine.
| Compound Name | 4-[2-[di(propan-2-yloxy)phosphorylmethoxy]ethoxy]pyrimidin-2-amine |
|---|---|
| PubChem CID | 10640381 |
| Molecular Formula | C13H24N3O5P |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 4-[2-[di(propan-2-yloxy)phosphorylmethoxy]ethoxy]pyrimidin-2-amine |
| SMILES | CC(C)OP(=O)(COCCOc1ccnc(N)n1)OC(C)C |
| InChI | InChI=1S/C13H24N3O5P/c1-10(2)20-22(17,21-11(3)4)9-18-7-8-19-12-5-6-15-13(14)16-12/h5-6,10-11H,7-9H2,1-4H3,(H2,14,15,16) |
| InChIKey | ZVPSPIPZWGHSOP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 105.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|