C11H19N3O5 — CID 106404893
2-[[2-(2-but-3-enoxyethylcarbamoylamino)acetyl]amino]acetic acid (PubChem CID 106404893) has the molecular formula C11H19N3O5 and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-[[2-(2-but-3-enoxyethylcarbamoylamino)acetyl]amino]acetic acid.
| Compound Name | 2-[[2-(2-but-3-enoxyethylcarbamoylamino)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 106404893 |
| Molecular Formula | C11H19N3O5 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-[[2-(2-but-3-enoxyethylcarbamoylamino)acetyl]amino]acetic acid |
| SMILES | C=CCCOCCNC(=O)NCC(=O)NCC(=O)O |
| InChI | InChI=1S/C11H19N3O5/c1-2-3-5-19-6-4-12-11(18)14-7-9(15)13-8-10(16)17/h2H,1,3-8H2,(H,13,15)(H,16,17)(H2,12,14,18) |
| InChIKey | QUYUUARNOXHVNB-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|