About 3-(1,2,4-oxadiazol-3-ylmethyl)-1H-imidazole-2-thione
3-(1,2,4-oxadiazol-3-ylmethyl)-1H-imidazole-2-thione (PubChem CID 106405202) has the molecular formula C6H6N4OS
and a molecular weight of 182.21 g/mol. Its IUPAC name is 3-(1,2,4-oxadiazol-3-ylmethyl)-1H-imidazole-2-thione.
Molecular Properties
| Compound Name | 3-(1,2,4-oxadiazol-3-ylmethyl)-1H-imidazole-2-thione |
| PubChem CID | 106405202 |
| Molecular Formula | C6H6N4OS |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 3-(1,2,4-oxadiazol-3-ylmethyl)-1H-imidazole-2-thione |
| SMILES | S=c1[nH]ccn1Cc1ncon1 |
| InChI | InChI=1S/C6H6N4OS/c12-6-7-1-2-10(6)3-5-8-4-11-9-5/h1-2,4H,3H2,(H,7,12) |
| InChIKey | LCZIIVUJLPNPMA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,2,4-oxadiazol-3-ylmethyl)-1H-imidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2,4-oxadiazol-3-ylmethyl)-1H-imidazole-2-thione?
The IUPAC name of 3-(1,2,4-oxadiazol-3-ylmethyl)-1H-imidazole-2-thione (CID 106405202) is 3-(1,2,4-oxadiazol-3-ylmethyl)-1H-imidazole-2-thione.
What is the SMILES notation for 3-(1,2,4-oxadiazol-3-ylmethyl)-1H-imidazole-2-thione?
The canonical SMILES for 3-(1,2,4-oxadiazol-3-ylmethyl)-1H-imidazole-2-thione is S=c1[nH]ccn1Cc1ncon1.
What is the InChIKey of 3-(1,2,4-oxadiazol-3-ylmethyl)-1H-imidazole-2-thione?
The InChIKey is LCZIIVUJLPNPMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4OS/c12-6-7-1-2-10(6)3-5-8-4-11-9-5/h1-2,4H,3H2,(H,7,12).
What are the key properties of 3-(1,2,4-oxadiazol-3-ylmethyl)-1H-imidazole-2-thione?
3-(1,2,4-oxadiazol-3-ylmethyl)-1H-imidazole-2-thione has a molecular weight of 182.21 g/mol, XLogP of 0.98, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2,4-oxadiazol-3-ylmethyl)-1H-imidazole-2-thione is sourced from PubChem (CID 106405202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).