C11H8ClN5O — CID 106405493
2-chloro-N-(1,2,4-oxadiazol-3-ylmethyl)quinazolin-4-amine (PubChem CID 106405493) has the molecular formula C11H8ClN5O and a molecular weight of 261.67 g/mol. Its IUPAC name is 2-chloro-N-(1,2,4-oxadiazol-3-ylmethyl)quinazolin-4-amine.
| Compound Name | 2-chloro-N-(1,2,4-oxadiazol-3-ylmethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 106405493 |
| Molecular Formula | C11H8ClN5O |
| Molecular Weight | 261.67 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 2-chloro-N-(1,2,4-oxadiazol-3-ylmethyl)quinazolin-4-amine |
| SMILES | Clc1nc(NCc2ncon2)c2ccccc2n1 |
| InChI | InChI=1S/C11H8ClN5O/c12-11-15-8-4-2-1-3-7(8)10(16-11)13-5-9-14-6-18-17-9/h1-4,6H,5H2,(H,13,15,16) |
| InChIKey | JAEKCAYIPVZQDU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.67 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |