About 6-fluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyrimidin-4-amine
6-fluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyrimidin-4-amine (PubChem CID 106405544) has the molecular formula C8H8FN5O
and a molecular weight of 209.18 g/mol. Its IUPAC name is 6-fluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-fluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyrimidin-4-amine |
| PubChem CID | 106405544 |
| Molecular Formula | C8H8FN5O |
| Molecular Weight | 209.18 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 6-fluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyrimidin-4-amine |
| SMILES | Fc1cc(NCCc2ncno2)ncn1 |
| InChI | InChI=1S/C8H8FN5O/c9-6-3-7(12-4-11-6)10-2-1-8-13-5-14-15-8/h3-5H,1-2H2,(H,10,11,12) |
| InChIKey | BZSGLKCCBIVHQP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.18 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-fluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyrimidin-4-amine?
The IUPAC name of 6-fluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyrimidin-4-amine (CID 106405544) is 6-fluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyrimidin-4-amine.
What is the SMILES notation for 6-fluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyrimidin-4-amine?
The canonical SMILES for 6-fluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyrimidin-4-amine is Fc1cc(NCCc2ncno2)ncn1.
What is the InChIKey of 6-fluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyrimidin-4-amine?
The InChIKey is BZSGLKCCBIVHQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FN5O/c9-6-3-7(12-4-11-6)10-2-1-8-13-5-14-15-8/h3-5H,1-2H2,(H,10,11,12).
What are the key properties of 6-fluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyrimidin-4-amine?
6-fluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyrimidin-4-amine has a molecular weight of 209.18 g/mol, XLogP of 0.65, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyrimidin-4-amine is sourced from PubChem (CID 106405544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).