C10H17N5O3 — CID 106405912
2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(1,2,4-oxadiazol-3-ylmethyl)butanamide (PubChem CID 106405912) has the molecular formula C10H17N5O3 and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(1,2,4-oxadiazol-3-ylmethyl)butanamide.
| Compound Name | 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(1,2,4-oxadiazol-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 106405912 |
| Molecular Formula | C10H17N5O3 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(1,2,4-oxadiazol-3-ylmethyl)butanamide |
| SMILES | CCC(CC)(C(=O)NCc1ncon1)C(N)=NO |
| InChI | InChI=1S/C10H17N5O3/c1-3-10(4-2,8(11)14-17)9(16)12-5-7-13-6-18-15-7/h6,17H,3-5H2,1-2H3,(H2,11,14)(H,12,16) |
| InChIKey | DCZPGJUZSLLEMD-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|