C11H9FIN5O — CID 106406214
6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine (PubChem CID 106406214) has the molecular formula C11H9FIN5O and a molecular weight of 373.13 g/mol. Its IUPAC name is 6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine.
| Compound Name | 6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 106406214 |
| Molecular Formula | C11H9FIN5O |
| Molecular Weight | 373.13 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine |
| SMILES | Nc1nc2cc(I)c(F)cc2n1CCc1ncno1 |
| InChI | InChI=1S/C11H9FIN5O/c12-6-3-9-8(4-7(6)13)17-11(14)18(9)2-1-10-15-5-16-19-10/h3-5H,1-2H2,(H2,14,17) |
| InChIKey | WINCXXBVGNDPOP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.13 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|