About 6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine
6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine (PubChem CID 106406214) has the molecular formula C11H9FIN5O
and a molecular weight of 373.13 g/mol. Its IUPAC name is 6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine.
Molecular Properties
| Compound Name | 6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine |
| PubChem CID | 106406214 |
| Molecular Formula | C11H9FIN5O |
| Molecular Weight | 373.13 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine |
| SMILES | Nc1nc2cc(I)c(F)cc2n1CCc1ncno1 |
| InChI | InChI=1S/C11H9FIN5O/c12-6-3-9-8(4-7(6)13)17-11(14)18(9)2-1-10-15-5-16-19-10/h3-5H,1-2H2,(H2,14,17) |
| InChIKey | WINCXXBVGNDPOP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.13 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine?
The IUPAC name of 6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine (CID 106406214) is 6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine.
What is the SMILES notation for 6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine?
The canonical SMILES for 6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine is Nc1nc2cc(I)c(F)cc2n1CCc1ncno1.
What is the InChIKey of 6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine?
The InChIKey is WINCXXBVGNDPOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FIN5O/c12-6-3-9-8(4-7(6)13)17-11(14)18(9)2-1-10-15-5-16-19-10/h3-5H,1-2H2,(H2,14,17).
What are the key properties of 6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine?
6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine has a molecular weight of 373.13 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-5-iodo-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzimidazol-2-amine is sourced from PubChem (CID 106406214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).