C21H23NO3 — CID 10640681
ethyl (2R,3S)-2-methyl-4-oxo-2-phenyl-1-[(1S)-1-phenylethyl]azetidine-3-carboxylate (PubChem CID 10640681) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is ethyl (2R,3S)-2-methyl-4-oxo-2-phenyl-1-[(1S)-1-phenylethyl]azetidine-3-carboxylate.
| Compound Name | ethyl (2R,3S)-2-methyl-4-oxo-2-phenyl-1-[(1S)-1-phenylethyl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 10640681 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | ethyl (2R,3S)-2-methyl-4-oxo-2-phenyl-1-[(1S)-1-phenylethyl]azetidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)N([C@@H](C)c2ccccc2)[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C21H23NO3/c1-4-25-20(24)18-19(23)22(15(2)16-11-7-5-8-12-16)21(18,3)17-13-9-6-10-14-17/h5-15,18H,4H2,1-3H3/t15-,18-,21-/m0/s1 |
| InChIKey | NWUMHJNAWORNJX-XERREHJYSA-N |
| XLogP | 3.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|