About N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)-2-oxoacetamide
N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)-2-oxoacetamide (PubChem CID 10640738) has the molecular formula C19H18N2O4
and a molecular weight of 338.36 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)-2-oxoacetamide.
Molecular Properties
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)-2-oxoacetamide |
| PubChem CID | 10640738 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)-2-oxoacetamide |
| SMILES | COc1ccc(CNC(=O)C(=O)c2c[nH]c3ccccc23)cc1OC |
| InChI | InChI=1S/C19H18N2O4/c1-24-16-8-7-12(9-17(16)25-2)10-21-19(23)18(22)14-11-20-15-6-4-3-5-13(14)15/h3-9,11,20H,10H2,1-2H3,(H,21,23) |
| InChIKey | VDAHGXKTABYDOQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)-2-oxoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)-2-oxoacetamide?
The IUPAC name of N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)-2-oxoacetamide (CID 10640738) is N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)-2-oxoacetamide.
What is the SMILES notation for N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)-2-oxoacetamide?
The canonical SMILES for N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)-2-oxoacetamide is COc1ccc(CNC(=O)C(=O)c2c[nH]c3ccccc23)cc1OC.
What is the InChIKey of N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)-2-oxoacetamide?
The InChIKey is VDAHGXKTABYDOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O4/c1-24-16-8-7-12(9-17(16)25-2)10-21-19(23)18(22)14-11-20-15-6-4-3-5-13(14)15/h3-9,11,20H,10H2,1-2H3,(H,21,23).
What are the key properties of N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)-2-oxoacetamide?
N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)-2-oxoacetamide has a molecular weight of 338.36 g/mol, XLogP of 2.68, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-indol-3-yl)-2-oxoacetamide is sourced from PubChem (CID 10640738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).