C19H17NOS2 — CID 10640837
4-oxa-7,15-dithia-3-azatetracyclo[15.2.2.12,5.19,13]tricosa-1(20),2,5(23),9,11,13(22),17(21),18-octaene (PubChem CID 10640837) has the molecular formula C19H17NOS2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 4-oxa-7,15-dithia-3-azatetracyclo[15.2.2.12,5.19,13]tricosa-1(20),2,5(23),9,11,13(22),17(21),18-octaene.
| Compound Name | 4-oxa-7,15-dithia-3-azatetracyclo[15.2.2.12,5.19,13]tricosa-1(20),2,5(23),9,11,13(22),17(21),18-octaene |
|---|---|
| PubChem CID | 10640837 |
| Molecular Formula | C19H17NOS2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 4-oxa-7,15-dithia-3-azatetracyclo[15.2.2.12,5.19,13]tricosa-1(20),2,5(23),9,11,13(22),17(21),18-octaene |
| SMILES | c1cc2cc(c1)CSCc1cc(no1)-c1ccc(cc1)CSC2 |
| InChI | InChI=1S/C19H17NOS2/c1-2-15-8-16(3-1)12-23-13-18-9-19(20-21-18)17-6-4-14(5-7-17)10-22-11-15/h1-9H,10-13H2 |
| InChIKey | FSKLHCAMIPFHTJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |