About 2-bromo-10H-indolo[3,2-b]quinoline-11-carboxamide
2-bromo-10H-indolo[3,2-b]quinoline-11-carboxamide (PubChem CID 10640851) has the molecular formula C16H10BrN3O
and a molecular weight of 340.18 g/mol. Its IUPAC name is 2-bromo-10H-indolo[3,2-b]quinoline-11-carboxamide.
Molecular Properties
| Compound Name | 2-bromo-10H-indolo[3,2-b]quinoline-11-carboxamide |
| PubChem CID | 10640851 |
| Molecular Formula | C16H10BrN3O |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 2-bromo-10H-indolo[3,2-b]quinoline-11-carboxamide |
| SMILES | NC(=O)c1c2cc(Br)ccc2nc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C16H10BrN3O/c17-8-5-6-12-10(7-8)13(16(18)21)15-14(19-12)9-3-1-2-4-11(9)20-15/h1-7,20H,(H2,18,21) |
| InChIKey | WJMOLTXLGFWETF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-10H-indolo[3,2-b]quinoline-11-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-10H-indolo[3,2-b]quinoline-11-carboxamide?
The IUPAC name of 2-bromo-10H-indolo[3,2-b]quinoline-11-carboxamide (CID 10640851) is 2-bromo-10H-indolo[3,2-b]quinoline-11-carboxamide.
What is the SMILES notation for 2-bromo-10H-indolo[3,2-b]quinoline-11-carboxamide?
The canonical SMILES for 2-bromo-10H-indolo[3,2-b]quinoline-11-carboxamide is NC(=O)c1c2cc(Br)ccc2nc2c1[nH]c1ccccc12.
What is the InChIKey of 2-bromo-10H-indolo[3,2-b]quinoline-11-carboxamide?
The InChIKey is WJMOLTXLGFWETF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10BrN3O/c17-8-5-6-12-10(7-8)13(16(18)21)15-14(19-12)9-3-1-2-4-11(9)20-15/h1-7,20H,(H2,18,21).
What are the key properties of 2-bromo-10H-indolo[3,2-b]quinoline-11-carboxamide?
2-bromo-10H-indolo[3,2-b]quinoline-11-carboxamide has a molecular weight of 340.18 g/mol, XLogP of 3.73, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-10H-indolo[3,2-b]quinoline-11-carboxamide is sourced from PubChem (CID 10640851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).