C12H22F6O2Si — CID 10640888
(3R)-4-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-3-methyl-2-(trifluoromethyl)butan-2-ol (PubChem CID 10640888) has the molecular formula C12H22F6O2Si and a molecular weight of 340.38 g/mol. Its IUPAC name is (3R)-4-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-3-methyl-2-(trifluoromethyl)butan-2-ol.
| Compound Name | (3R)-4-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-3-methyl-2-(trifluoromethyl)butan-2-ol |
|---|---|
| PubChem CID | 10640888 |
| Molecular Formula | C12H22F6O2Si |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (3R)-4-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-3-methyl-2-(trifluoromethyl)butan-2-ol |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H22F6O2Si/c1-8(7-20-21(5,6)9(2,3)4)10(19,11(13,14)15)12(16,17)18/h8,19H,7H2,1-6H3/t8-/m1/s1 |
| InChIKey | JZKSEFCOGGETPK-MRVPVSSYSA-N |
| XLogP | 4.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|