C17H24O5S — CID 10640909
[(3aS,4R,5S,6S,6aS)-3a-hydroxy-4,5,6a-trimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6-yl] 4-methylbenzenesulfonate (PubChem CID 10640909) has the molecular formula C17H24O5S and a molecular weight of 340.44 g/mol. Its IUPAC name is [(3aS,4R,5S,6S,6aS)-3a-hydroxy-4,5,6a-trimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3aS,4R,5S,6S,6aS)-3a-hydroxy-4,5,6a-trimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10640909 |
| Molecular Formula | C17H24O5S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | [(3aS,4R,5S,6S,6aS)-3a-hydroxy-4,5,6a-trimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2[C@@H](C)[C@@H](C)[C@@]3(O)CCO[C@@]23C)cc1 |
| InChI | InChI=1S/C17H24O5S/c1-11-5-7-14(8-6-11)23(19,20)22-15-12(2)13(3)17(18)9-10-21-16(15,17)4/h5-8,12-13,15,18H,9-10H2,1-4H3/t12-,13+,15-,16-,17-/m0/s1 |
| InChIKey | PCDAYASVHBESTA-KUHBDSFDSA-N |
| XLogP | 2.26 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|