C16H32N2O — CID 106409163
1-(2-but-3-enoxyethyl)-5-tert-butyl-2-ethylpiperazine (PubChem CID 106409163) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is 1-(2-but-3-enoxyethyl)-5-tert-butyl-2-ethylpiperazine.
| Compound Name | 1-(2-but-3-enoxyethyl)-5-tert-butyl-2-ethylpiperazine |
|---|---|
| PubChem CID | 106409163 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | 1-(2-but-3-enoxyethyl)-5-tert-butyl-2-ethylpiperazine |
| SMILES | C=CCCOCCN1CC(C(C)(C)C)NCC1CC |
| InChI | InChI=1S/C16H32N2O/c1-6-8-10-19-11-9-18-13-15(16(3,4)5)17-12-14(18)7-2/h6,14-15,17H,1,7-13H2,2-5H3 |
| InChIKey | VWVKZWAATAMFPW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|