C11H12N6O4 — CID 106409218
4-hydrazinyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-nitrobenzamide (PubChem CID 106409218) has the molecular formula C11H12N6O4 and a molecular weight of 292.26 g/mol. Its IUPAC name is 4-hydrazinyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-nitrobenzamide.
| Compound Name | 4-hydrazinyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 106409218 |
| Molecular Formula | C11H12N6O4 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 4-hydrazinyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-nitrobenzamide |
| SMILES | Cc1nc(CNC(=O)c2ccc(NN)c([N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C11H12N6O4/c1-6-14-10(16-21-6)5-13-11(18)7-2-3-8(15-12)9(4-7)17(19)20/h2-4,15H,5,12H2,1H3,(H,13,18) |
| InChIKey | HIZUYYXIHHIDCP-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|