About 1-hydroxy-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine
1-hydroxy-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine (PubChem CID 106409475) has the molecular formula C5H9N5O2
and a molecular weight of 171.16 g/mol. Its IUPAC name is 1-hydroxy-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine.
Molecular Properties
| Compound Name | 1-hydroxy-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine |
| PubChem CID | 106409475 |
| Molecular Formula | C5H9N5O2 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 1-hydroxy-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine |
| SMILES | N/C(=N\CCc1ncno1)NO |
| InChI | InChI=1S/C5H9N5O2/c6-5(10-11)7-2-1-4-8-3-9-12-4/h3,11H,1-2H2,(H3,6,7,10) |
| InChIKey | BPBYTVNFTWEBNL-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine?
The IUPAC name of 1-hydroxy-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine (CID 106409475) is 1-hydroxy-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine.
What is the SMILES notation for 1-hydroxy-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine?
The canonical SMILES for 1-hydroxy-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine is N/C(=N\CCc1ncno1)NO.
What is the InChIKey of 1-hydroxy-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine?
The InChIKey is BPBYTVNFTWEBNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5O2/c6-5(10-11)7-2-1-4-8-3-9-12-4/h3,11H,1-2H2,(H3,6,7,10).
What are the key properties of 1-hydroxy-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine?
1-hydroxy-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine has a molecular weight of 171.16 g/mol, XLogP of -1.09, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine is sourced from PubChem (CID 106409475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).