C17H21ClO3S — CID 10640948
(1S,6R,9R,12S)-12-(4-chlorophenyl)sulfanyl-9-methyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane (PubChem CID 10640948) has the molecular formula C17H21ClO3S and a molecular weight of 340.87 g/mol. Its IUPAC name is (1S,6R,9R,12S)-12-(4-chlorophenyl)sulfanyl-9-methyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane.
| Compound Name | (1S,6R,9R,12S)-12-(4-chlorophenyl)sulfanyl-9-methyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane |
|---|---|
| PubChem CID | 10640948 |
| Molecular Formula | C17H21ClO3S |
| Molecular Weight | 340.87 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (1S,6R,9R,12S)-12-(4-chlorophenyl)sulfanyl-9-methyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane |
| SMILES | C[C@]12CC[C@H]3CCCC[C@@]3(OO1)[C@H](Sc1ccc(Cl)cc1)O2 |
| InChI | InChI=1S/C17H21ClO3S/c1-16-11-9-12-4-2-3-10-17(12,21-20-16)15(19-16)22-14-7-5-13(18)6-8-14/h5-8,12,15H,2-4,9-11H2,1H3/t12-,15+,16-,17+/m1/s1 |
| InChIKey | IZEJARLFJRHQIR-ZFVVBOAOSA-N |
| XLogP | 5.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.87 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|