C14H14N4O3 — CID 106409640
1-[2-(1,2,4-oxadiazol-3-yl)ethyl]-3-phenylpiperazine-2,5-dione (PubChem CID 106409640) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 1-[2-(1,2,4-oxadiazol-3-yl)ethyl]-3-phenylpiperazine-2,5-dione.
| Compound Name | 1-[2-(1,2,4-oxadiazol-3-yl)ethyl]-3-phenylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 106409640 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1-[2-(1,2,4-oxadiazol-3-yl)ethyl]-3-phenylpiperazine-2,5-dione |
| SMILES | O=C1CN(CCc2ncon2)C(=O)C(c2ccccc2)N1 |
| InChI | InChI=1S/C14H14N4O3/c19-12-8-18(7-6-11-15-9-21-17-11)14(20)13(16-12)10-4-2-1-3-5-10/h1-5,9,13H,6-8H2,(H,16,19) |
| InChIKey | XSHLNKIEJAXCGA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |