C9H15N3O3 — CID 106409914
4-hydroxy-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]pentanamide (PubChem CID 106409914) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 4-hydroxy-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]pentanamide.
| Compound Name | 4-hydroxy-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 106409914 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 4-hydroxy-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]pentanamide |
| SMILES | CC(O)CCC(=O)NCCc1ncon1 |
| InChI | InChI=1S/C9H15N3O3/c1-7(13)2-3-9(14)10-5-4-8-11-6-15-12-8/h6-7,13H,2-5H2,1H3,(H,10,14) |
| InChIKey | BVOLECQGWUZFAF-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |