C8H12N4O2 — CID 106409993
1-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1,3-diazinan-2-one (PubChem CID 106409993) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1,3-diazinan-2-one.
| Compound Name | 1-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 106409993 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1CCc1ncno1 |
| InChI | InChI=1S/C8H12N4O2/c13-8-9-3-1-4-12(8)5-2-7-10-6-11-14-7/h6H,1-5H2,(H,9,13) |
| InChIKey | OSXPQFRAAJXTHS-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |