C20H14N4O2 — CID 10641040
10-benzyl-3-(furan-2-yl)-[1,2,4]triazino[4,3-a]benzimidazol-4-one (PubChem CID 10641040) has the molecular formula C20H14N4O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is 10-benzyl-3-(furan-2-yl)-[1,2,4]triazino[4,3-a]benzimidazol-4-one.
| Compound Name | 10-benzyl-3-(furan-2-yl)-[1,2,4]triazino[4,3-a]benzimidazol-4-one |
|---|---|
| PubChem CID | 10641040 |
| Molecular Formula | C20H14N4O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 10-benzyl-3-(furan-2-yl)-[1,2,4]triazino[4,3-a]benzimidazol-4-one |
| SMILES | O=c1c(-c2ccco2)nnc2n(Cc3ccccc3)c3ccccc3n12 |
| InChI | InChI=1S/C20H14N4O2/c25-19-18(17-11-6-12-26-17)21-22-20-23(13-14-7-2-1-3-8-14)15-9-4-5-10-16(15)24(19)20/h1-12H,13H2 |
| InChIKey | LAKWSLSTUWRCOM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 65.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |