C15H20O9 — CID 10641158
2-O-[(1S,2R,3S)-2-[(1S)-3-(acetyloxymethyl)-1-hydroxybut-3-enyl]-3-methoxycarbonylcyclopropyl] 1-O-methyl oxalate (PubChem CID 10641158) has the molecular formula C15H20O9 and a molecular weight of 344.32 g/mol. Its IUPAC name is 2-O-[(1S,2R,3S)-2-[(1S)-3-(acetyloxymethyl)-1-hydroxybut-3-enyl]-3-methoxycarbonylcyclopropyl] 1-O-methyl oxalate.
| Compound Name | 2-O-[(1S,2R,3S)-2-[(1S)-3-(acetyloxymethyl)-1-hydroxybut-3-enyl]-3-methoxycarbonylcyclopropyl] 1-O-methyl oxalate |
|---|---|
| PubChem CID | 10641158 |
| Molecular Formula | C15H20O9 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-O-[(1S,2R,3S)-2-[(1S)-3-(acetyloxymethyl)-1-hydroxybut-3-enyl]-3-methoxycarbonylcyclopropyl] 1-O-methyl oxalate |
| SMILES | C=C(COC(C)=O)C[C@H](O)[C@@H]1[C@H](OC(=O)C(=O)OC)[C@H]1C(=O)OC |
| InChI | InChI=1S/C15H20O9/c1-7(6-23-8(2)16)5-9(17)10-11(13(18)21-3)12(10)24-15(20)14(19)22-4/h9-12,17H,1,5-6H2,2-4H3/t9-,10-,11-,12-/m0/s1 |
| InChIKey | RGKHUAIZPWMMLX-BJDJZHNGSA-N |
| XLogP | -0.64 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|