C12H7ClF6N2O — CID 10641215
2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-8-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 10641215) has the molecular formula C12H7ClF6N2O and a molecular weight of 344.64 g/mol. Its IUPAC name is 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-8-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-8-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 10641215 |
| Molecular Formula | C12H7ClF6N2O |
| Molecular Weight | 344.64 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-8-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1ccn2c(=O)cc(C(F)(F)C(F)(F)C(F)(F)Cl)nc2c1 |
| InChI | InChI=1S/C12H7ClF6N2O/c1-6-2-3-21-8(4-6)20-7(5-9(21)22)10(14,15)11(16,17)12(13,18)19/h2-5H,1H3 |
| InChIKey | GUJBEKROJANNAU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.64 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|