C16H10Cl2N4O — CID 10641219
1-(4-chlorophenyl)-N-[4-[(4-chlorophenyl)methylideneamino]-1,2,5-oxadiazol-3-yl]methanimine (PubChem CID 10641219) has the molecular formula C16H10Cl2N4O and a molecular weight of 345.19 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[4-[(4-chlorophenyl)methylideneamino]-1,2,5-oxadiazol-3-yl]methanimine.
| Compound Name | 1-(4-chlorophenyl)-N-[4-[(4-chlorophenyl)methylideneamino]-1,2,5-oxadiazol-3-yl]methanimine |
|---|---|
| PubChem CID | 10641219 |
| Molecular Formula | C16H10Cl2N4O |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[4-[(4-chlorophenyl)methylideneamino]-1,2,5-oxadiazol-3-yl]methanimine |
| SMILES | Clc1ccc(/C=N/c2nonc2/N=C/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H10Cl2N4O/c17-13-5-1-11(2-6-13)9-19-15-16(22-23-21-15)20-10-12-3-7-14(18)8-4-12/h1-10H/b19-9+,20-10+ |
| InChIKey | SYWVLFWNIWRPSD-LQGKIZFRSA-N |
| XLogP | 4.88 |
| TPSA | 63.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|