C18H23N3O4 — CID 10641248
diethyl (1R,4S)-7-[(4-aminophenyl)methylidene]-2,3-diazabicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 10641248) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is diethyl (1R,4S)-7-[(4-aminophenyl)methylidene]-2,3-diazabicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | diethyl (1R,4S)-7-[(4-aminophenyl)methylidene]-2,3-diazabicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10641248 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | diethyl (1R,4S)-7-[(4-aminophenyl)methylidene]-2,3-diazabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | CCOC(=O)N1[C@@H]2CC[C@@H](/C2=C\c2ccc(N)cc2)N1C(=O)OCC |
| InChI | InChI=1S/C18H23N3O4/c1-3-24-17(22)20-15-9-10-16(21(20)18(23)25-4-2)14(15)11-12-5-7-13(19)8-6-12/h5-8,11,15-16H,3-4,9-10,19H2,1-2H3/b14-11-/t15-,16+/m1/s1 |
| InChIKey | GYCZAZZESLVNOR-PSRIFBLRSA-N |
| XLogP | 3.03 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|