C12H15N5O2 — CID 106413318
3,5-diamino-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]benzamide (PubChem CID 106413318) has the molecular formula C12H15N5O2 and a molecular weight of 261.29 g/mol. Its IUPAC name is 3,5-diamino-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]benzamide.
| Compound Name | 3,5-diamino-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 106413318 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 3,5-diamino-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]benzamide |
| SMILES | Cc1noc(CCNC(=O)c2cc(N)cc(N)c2)n1 |
| InChI | InChI=1S/C12H15N5O2/c1-7-16-11(19-17-7)2-3-15-12(18)8-4-9(13)6-10(14)5-8/h4-6H,2-3,13-14H2,1H3,(H,15,18) |
| InChIKey | JKMKUOYUHMXSJK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 120.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|