C11H15N3O4 — CID 106414663
2,3-dimethyl-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobut-2-enoic acid (PubChem CID 106414663) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2,3-dimethyl-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobut-2-enoic acid.
| Compound Name | 2,3-dimethyl-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 106414663 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2,3-dimethyl-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)NCCc1noc(C)n1 |
| InChI | InChI=1S/C11H15N3O4/c1-6(7(2)11(16)17)10(15)12-5-4-9-13-8(3)18-14-9/h4-5H2,1-3H3,(H,12,15)(H,16,17) |
| InChIKey | FMKJPPLYHRZYRT-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|