C16H36O4Si2 — CID 10641490
(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(2-trimethylsilylethoxymethoxy)butanal (PubChem CID 10641490) has the molecular formula C16H36O4Si2 and a molecular weight of 348.63 g/mol. Its IUPAC name is (3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(2-trimethylsilylethoxymethoxy)butanal.
| Compound Name | (3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(2-trimethylsilylethoxymethoxy)butanal |
|---|---|
| PubChem CID | 10641490 |
| Molecular Formula | C16H36O4Si2 |
| Molecular Weight | 348.63 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(2-trimethylsilylethoxymethoxy)butanal |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](CC=O)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C16H36O4Si2/c1-16(2,3)22(7,8)20-13-15(9-10-17)19-14-18-11-12-21(4,5)6/h10,15H,9,11-14H2,1-8H3/t15-/m0/s1 |
| InChIKey | HFWOEVFFNHSFBS-HNNXBMFYSA-N |
| XLogP | 4.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.63 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|