C14H23N3O3 — CID 106415109
tert-butyl N-[3-(1,2-oxazol-5-ylmethylamino)cyclopentyl]carbamate (PubChem CID 106415109) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is tert-butyl N-[3-(1,2-oxazol-5-ylmethylamino)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[3-(1,2-oxazol-5-ylmethylamino)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 106415109 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | tert-butyl N-[3-(1,2-oxazol-5-ylmethylamino)cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(NCc2ccno2)C1 |
| InChI | InChI=1S/C14H23N3O3/c1-14(2,3)19-13(18)17-11-5-4-10(8-11)15-9-12-6-7-16-20-12/h6-7,10-11,15H,4-5,8-9H2,1-3H3,(H,17,18) |
| InChIKey | OEEJJIODWFVTRP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |